ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
497-03-0 2-methyl-2-butenal |
|
Nazwa produktu: | 2-methyl-2-butenal |
Angielska nazwa | 2-methyl-2-butenal;Methylbutenal;tiglaldehyde;guaiol;2-Methylcrotonaldehyde~Tiglic aldehyde |
MF | C5H8O |
Masie cząsteczkowej | 84.11 |
InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
Nr CAS | 497-03-0 |
EINECS | 207-833-0 |
Struktury molekularnej | ![]() |
Gęstość | 0.871 |
Temperatura wrzenia | 115-118℃ (752 torr) |
Współczynnik załamania | 1.447 |
Temperatura zapłonu | 18℃ |
Symbole zagrożenia | |
Kody ryzyka | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |