ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53-96-3 2-Acetamidofluorene |
|
| Nazwa produktu: | 2-Acetamidofluorene |
| Angielska nazwa | 2-Acetamidofluorene;N-(2-Fluorenyl)acetamide;Acetamidofluorene;N-(9H-fluoren-2-yl)acetamide;2-(9H-fluoren-2-yl)acetamide |
| MF | C15H13NO |
| Masie cząsteczkowej | 223.2698 |
| InChI | InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
| Nr CAS | 53-96-3 |
| EINECS | 200-188-6 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.227g/cm3 |
| Temperatura topnienia | 192-196℃ |
| Temperatura wrzenia | 471.2°C at 760 mmHg |
| Współczynnik załamania | 1.656 |
| Temperatura zapłonu | 238.8°C |
| Rozpuszczalność w wodzie | 0.000529 g/100 mL |
| Ciśnienie pary | 4.73E-09mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R46##May cause heritable genetic damages.:; |
| Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |