Chemindex > 56107-02-9
PL ▼
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
| Nazwa produktu: | 4-Chloro-3-nitrobenzophenone |
| Angielska nazwa | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
| MF | C13H8ClNO3 |
| Masie cząsteczkowej | 261.6605 |
| InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| Nr CAS | 56107-02-9 |
| EINECS | 259-995-7 |
| Struktury molekularnej |  |
| Gęstość | 1.367g/cm3 |
| Temperatura topnienia | 101-107℃ |
| Temperatura wrzenia | 386.5°C at 760 mmHg |
| Współczynnik załamania | 1.623 |
| Temperatura zapłonu | 203.4°C |
| Ciśnienie pary | 3.53E-06mmHg at 25°C |
| Symbole zagrożenia |  Xn##Harmful:; |
| Kody ryzyka | R20/21##Harmful by inhalation and in contact with skin.:; |
| Bezpieczeństwo opis | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 