ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
703-59-3 Homophthalic anhydride |
|
| Nazwa produktu: | Homophthalic anhydride |
| Angielska nazwa | Homophthalic anhydride;1,3-Isochromandione;benzoglutaric anhydride;1H-isochromene-1,3(4H)-dione;o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
| MF | C9H6O3 |
| Masie cząsteczkowej | 162.1421 |
| InChI | InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
| Nr CAS | 703-59-3 |
| EINECS | 211-873-4 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.347g/cm3 |
| Temperatura topnienia | 140-144℃ |
| Temperatura wrzenia | 324.5°C at 760 mmHg |
| Współczynnik załamania | 1.584 |
| Temperatura zapłonu | 159°C |
| Ciśnienie pary | 0.000244mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |