ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
| Nazwa produktu: | Bromodichloromethane |
| Angielska nazwa | Bromodichloromethane;FC-20B1 |
| MF | CHBrCl2 |
| Masie cząsteczkowej | 163.8286 |
| InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| Nr CAS | 75-27-4 |
| EINECS | 200-856-7 |
| Struktury molekularnej | ![]() |
| Gęstość | 2.013g/cm3 |
| Temperatura topnienia | -55℃ |
| Temperatura wrzenia | 89.7°C at 760 mmHg |
| Współczynnik załamania | 1.503 |
| Temperatura zapłonu | 1.3°C |
| Ciśnienie pary | 65.3mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| Bezpieczeństwo opis | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |