ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
78302-26-8 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole |
|
| Nazwa produktu: | 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole |
| Angielska nazwa | 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole; |
| MF | C11H8D4Cl2N2O |
| Masie cząsteczkowej | 263.1564 |
| InChI | InChI=1/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15)/i5D2,6D2 |
| Nr CAS | 78302-26-8 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.412g/cm3 |
| Temperatura wrzenia | 421.517°C at 760 mmHg |
| Współczynnik załamania | 1.611 |
| Temperatura zapłonu | 208.726°C |
| Ciśnienie pary | 0mmHg at 25°C |
| MSDS | |