ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-68-8 pentachloronitrobenzene |
|
| Nazwa produktu: | pentachloronitrobenzene |
| Angielska nazwa | pentachloronitrobenzene;101brandpcnb75wettable;ai-23024;avicol(pesticide);Avicol, pesticide;Batrilex;Benzene,pentachloronitro-;Botrilex |
| MF | C6Cl5NO2 |
| Masie cząsteczkowej | 295.34 |
| InChI | InChI=1/C6Cl5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| Nr CAS | 82-68-8 |
| EINECS | 201-435-0 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.718 |
| Temperatura topnienia | 144℃ |
| Temperatura wrzenia | 328℃ |
| Rozpuszczalność w wodzie | Insoluble |
| Symbole zagrożenia | |
| Kody ryzyka | R43||R50/53:; |
| Bezpieczeństwo opis | S13||S24||S37||S60||S61:; |
| MSDS | |