ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
830-03-5 4-Nitrophenyl acetate |
|
Nazwa produktu: | 4-Nitrophenyl acetate |
Angielska nazwa | 4-Nitrophenyl acetate;Acetic acid 4-nitrophenyl ester;p-Nitrophenol acetate |
MF | C8H7NO4 |
Masie cząsteczkowej | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
Nr CAS | 830-03-5 |
EINECS | 212-593-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.304g/cm3 |
Temperatura topnienia | 76-79℃ |
Temperatura wrzenia | 296.8°C at 760 mmHg |
Współczynnik załamania | 1.548 |
Temperatura zapłonu | 145.2°C |
Ciśnienie pary | 0.0014mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |