ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-26-0 2-Methoxybiphenyl |
|
| Nazwa produktu: | 2-Methoxybiphenyl |
| Angielska nazwa | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
| MF | C13H12O |
| Masie cząsteczkowej | 184.2338 |
| InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| Nr CAS | 86-26-0 |
| EINECS | 201-659-9 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.03g/cm3 |
| Temperatura topnienia | 30-33℃ |
| Temperatura wrzenia | 274°C at 760 mmHg |
| Współczynnik załamania | 1.556 |
| Temperatura zapłonu | 101.3°C |
| Ciśnienie pary | 0.00928mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R33##Danger of cummulative effects.:; |
| Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |