ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
| Nome do produto | 3-Hydroxyphenylacetylene |
| Nome em inglês | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
| Fórmula molecular | C8H6O |
| Peso Molecular | 118.1326 |
| InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS Registry Number | 10401-11-3 |
| Estrutura Molecular | ![]() |
| Densidade | 1.12g/cm3 |
| Ponto de ebulição | 230.9°C at 760 mmHg |
| índice de refração | 1.589 |
| O ponto de inflamação | 106.1°C |
| Pressão de vapor | 0.0424mmHg at 25°C |
| Códigos de risco | R36/38##Irritating to eyes and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |