ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13135-13-2 4-(diphenylmethylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
|
| Nome do produto | 4-(diphenylmethylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
| Nome em inglês | 4-(diphenylmethylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one; |
| Fórmula molecular | C21H18O |
| Peso Molecular | 286.367 |
| InChI | InChI=1/C21H18O/c1-15-13-19(14-16(2)21(15)22)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| CAS Registry Number | 13135-13-2 |
| Estrutura Molecular | ![]() |
| Densidade | 1.102g/cm3 |
| Ponto de ebulição | 465°C at 760 mmHg |
| índice de refração | 1.61 |
| O ponto de inflamação | 204.5°C |
| Pressão de vapor | 7.95E-09mmHg at 25°C |
| MSDS | |