ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-53-3 Iodoacetic acid, sodium salt |
|
| Nome do produto | Iodoacetic acid, sodium salt |
| Nome em inglês | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
| Fórmula molecular | C2H2INaO2 |
| Peso Molecular | 207.9303 |
| InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| CAS Registry Number | 305-53-3 |
| EINECS | 206-165-7 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 208-210℃ |
| Ponto de ebulição | 262.1°C at 760 mmHg |
| O ponto de inflamação | 112.3°C |
| Pressão de vapor | 0.00329mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |