ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
317830-29-8 3-[(1R)-1-aminoethyl]aniline |
|
| Nome do produto | 3-[(1R)-1-aminoethyl]aniline |
| Nome em inglês | 3-[(1R)-1-aminoethyl]aniline;(R)-3-Amino-α-methyl-benzenemethanamine;3-[(1R)-1-Aminoethyl]aniline;benzenemethanamine, 3-amino-α-methyl-, (alphaR)- |
| Fórmula molecular | C8H12N2 |
| Peso Molecular | 136.1943 |
| InChI | InChI=1/C8H12N2/c1-6(9)7-3-2-4-8(10)5-7/h2-6H,9-10H2,1H3/t6-/m1/s1 |
| CAS Registry Number | 317830-29-8 |
| Estrutura Molecular | ![]() |
| Densidade | 1.056g/cm3 |
| Ponto de ebulição | 266.5°C at 760 mmHg |
| índice de refração | 1.59 |
| O ponto de inflamação | 135.2°C |
| Pressão de vapor | 0.00863mmHg at 25°C |
| MSDS | |