ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
| Nome do produto | Monoethylpimelate |
| Nome em inglês | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
| Fórmula molecular | C9H16O4 |
| Peso Molecular | 188.2209 |
| InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| CAS Registry Number | 33018-91-6 |
| EINECS | 251-346-6 |
| Estrutura Molecular | ![]() |
| Densidade | 1.074g/cm3 |
| Ponto de ebulição | 288.7°C at 760 mmHg |
| índice de refração | 1.449 |
| O ponto de inflamação | 108°C |
| Pressão de vapor | 0.000581mmHg at 25°C |
| Códigos de risco | R36/38##Irritating to eyes and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |