ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 39828-35-8 2,4- dimethoxybenzoyl chloride | |
| Nome do produto | 2,4- dimethoxybenzoyl chloride | 
| Nome em inglês | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- | 
| Fórmula molecular | C9H9ClO3 | 
| Peso Molecular | 200.619 | 
| InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 | 
| CAS Registry Number | 39828-35-8 | 
| Estrutura Molecular |  | 
| Densidade | 1.224g/cm3 | 
| Ponto de fusão | 58℃ | 
| Ponto de ebulição | 306.7°C at 760 mmHg | 
| índice de refração | 1.52 | 
| O ponto de inflamação | 134.1°C | 
| Pressão de vapor | 0.000757mmHg at 25°C | 
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.:; | 
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |