ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-63-1 1-(3-fluorophenyl)ethanol |
|
| Nome do produto | 1-(3-fluorophenyl)ethanol |
| Nome em inglês | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
| Fórmula molecular | C8H9FO |
| Peso Molecular | 140.1549 |
| InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| CAS Registry Number | 402-63-1 |
| EINECS | 206-950-4 |
| Estrutura Molecular | ![]() |
| Densidade | 1.123g/cm3 |
| Ponto de ebulição | 196.2°C at 760 mmHg |
| índice de refração | 1.51 |
| O ponto de inflamação | 90.1°C |
| Pressão de vapor | 0.251mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |