ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-53-0 1,2-Dihydronaphthalene |
|
| Nome do produto | 1,2-Dihydronaphthalene |
| Nome em inglês | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
| Fórmula molecular | C10H10 |
| Peso Molecular | 130.1864 |
| InChI | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| CAS Registry Number | 447-53-0 |
| EINECS | 207-183-8 |
| Estrutura Molecular | ![]() |
| Densidade | 1.004g/cm3 |
| Ponto de fusão | -8℃ |
| Ponto de ebulição | 204.9°C at 760 mmHg |
| índice de refração | 1.572 |
| O ponto de inflamação | 70.4°C |
| Pressão de vapor | 0.367mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |