ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
| Nome do produto | 1-(3-fluorophenyl)-2-thiourea |
| Nome em inglês | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
| Fórmula molecular | C7H7FN2S |
| Peso Molecular | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS Registry Number | 458-05-9 |
| Estrutura Molecular | ![]() |
| Densidade | 1.397g/cm3 |
| Ponto de ebulição | 259.3°C at 760 mmHg |
| índice de refração | 1.692 |
| O ponto de inflamação | 110.6°C |
| Pressão de vapor | 0.0131mmHg at 25°C |
| Códigos de risco | R25##Toxic if swallowed.:; |
| Descrição da Segurança | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |