ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52498-24-5 N-{4-[(1E)-1-etil-2-(4-hidroxifenil)but-1-en-1-il]fenil}-N-hidroxiacetamida |
|
| Nome do produto | N-{4-[(1E)-1-etil-2-(4-hidroxifenil)but-1-en-1-il]fenil}-N-hidroxiacetamida |
| Nome em inglês | N-{4-[(1E)-1-ethyl-2-(4-hydroxyphenyl)but-1-en-1-yl]phenyl}-N-hydroxyacetamide; |
| Fórmula molecular | C20H23NO3 |
| Peso Molecular | 325.4015 |
| InChI | InChI=1/C20H23NO3/c1-4-19(20(5-2)16-8-12-18(23)13-9-16)15-6-10-17(11-7-15)21(24)14(3)22/h6-13,23-24H,4-5H2,1-3H3/b20-19+ |
| CAS Registry Number | 52498-24-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.177g/cm3 |
| Ponto de ebulição | 497°C at 760 mmHg |
| índice de refração | 1.62 |
| O ponto de inflamação | 254.4°C |
| Pressão de vapor | 1.08E-10mmHg at 25°C |
| MSDS | |