ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53757-30-5 N-{4-[(E)-2-(5-nitrofurano-2-il)etenil]-1,3-tiazol-2-il}formamida |
|
| Nome do produto | N-{4-[(E)-2-(5-nitrofurano-2-il)etenil]-1,3-tiazol-2-il}formamida |
| Nome em inglês | N-{4-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,3-thiazol-2-yl}formamide; |
| Fórmula molecular | C10H7N3O4S |
| Peso Molecular | 265.2453 |
| InChI | InChI=1/C10H7N3O4S/c14-6-11-10-12-7(5-18-10)1-2-8-3-4-9(17-8)13(15)16/h1-6H,(H,11,12,14)/b2-1+ |
| CAS Registry Number | 53757-30-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.59g/cm3 |
| Ponto de ebulição | 451.9°C at 760 mmHg |
| índice de refração | 1.762 |
| O ponto de inflamação | 227.1°C |
| Pressão de vapor | 2.35E-08mmHg at 25°C |
| MSDS | |