ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5444-08-6 6-[(4-methylphenyl)sulfanyl]-5H-purine |
|
| Nome do produto | 6-[(4-methylphenyl)sulfanyl]-5H-purine |
| Nome em inglês | 6-[(4-methylphenyl)sulfanyl]-5H-purine; |
| Fórmula molecular | C12H10N4S |
| Peso Molecular | 242.2996 |
| InChI | InChI=1/C12H10N4S/c1-8-2-4-9(5-3-8)17-12-10-11(14-6-13-10)15-7-16-12/h2-7,10H,1H3 |
| CAS Registry Number | 5444-08-6 |
| Estrutura Molecular | ![]() |
| Densidade | 1.4g/cm3 |
| Ponto de ebulição | 401.7°C at 760 mmHg |
| índice de refração | 1.745 |
| O ponto de inflamação | 196.8°C |
| Pressão de vapor | 2.68E-06mmHg at 25°C |
| MSDS | |