ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59-82-5 5-Nitro-2-furonitrile |
|
| Nome do produto | 5-Nitro-2-furonitrile |
| Nome em inglês | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
| Fórmula molecular | C5H2N2O3 |
| Peso Molecular | 138.081 |
| InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS Registry Number | 59-82-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.46g/cm3 |
| Ponto de ebulição | 234.7°C at 760 mmHg |
| índice de refração | 1.544 |
| O ponto de inflamação | 95.7°C |
| Pressão de vapor | 0.0522mmHg at 25°C |
| Códigos de risco | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Descrição da Segurança | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |