ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-76-8 4-hydroxy-3,5-diiodobenzoic acid | |
| Nome do produto | 4-hydroxy-3,5-diiodobenzoic acid | 
| Nome em inglês | 4-hydroxy-3,5-diiodobenzoic acid;3,5-Diiodo-4-hydroxybenzoic acid | 
| Fórmula molecular | C7H4I2O3 | 
| Peso Molecular | 389.9138 | 
| InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) | 
| CAS Registry Number | 618-76-8 | 
| EINECS | 210-562-0 | 
| Estrutura Molecular |  | 
| Densidade | 2.697g/cm3 | 
| Ponto de ebulição | 346.4°C at 760 mmHg | 
| índice de refração | 1.784 | 
| O ponto de inflamação | 163.3°C | 
| Pressão de vapor | 2.19E-05mmHg at 25°C | 
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
| MSDS | |