ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 619-01-2 dihidrocarveol, mistura de isômeros | |
| Nome do produto | dihidrocarveol, mistura de isômeros | 
| Sinônimos | ;D ihydrocarveol, mistura de isómeros; | 
| Nome em inglês | dihydrocarveol, mixture of isomers;Dihydrocarveol,mixture of isomers | 
| Fórmula molecular | C10H18O | 
| Peso Molecular | 154.2493 | 
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3 | 
| CAS Registry Number | 619-01-2 | 
| EINECS | 210-575-1 | 
| Estrutura Molecular |  | 
| Ponto de ebulição | 224℃ | 
| MSDS | |