ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7145-15-5 4-(2,2-diphenylethenyl)morpholine |
|
| Nome do produto | 4-(2,2-diphenylethenyl)morpholine |
| Nome em inglês | 4-(2,2-diphenylethenyl)morpholine;4-(2,2-Diphenylvinyl)morpholine |
| Fórmula molecular | C18H19NO |
| Peso Molecular | 265.3496 |
| InChI | InChI=1/C18H19NO/c1-3-7-16(8-4-1)18(17-9-5-2-6-10-17)15-19-11-13-20-14-12-19/h1-10,15H,11-14H2 |
| CAS Registry Number | 7145-15-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.138g/cm3 |
| Ponto de ebulição | 413.8°C at 760 mmHg |
| índice de refração | 1.639 |
| O ponto de inflamação | 121.5°C |
| Pressão de vapor | 4.66E-07mmHg at 25°C |
| MSDS | |