ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
| Nome do produto | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
| Nome em inglês | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
| Fórmula molecular | C14H10Cl4 |
| Peso Molecular | 320.04 |
| InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| CAS Registry Number | 72-54-8 |
| EINECS | 200-783-0 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 109-111℃ |
| Símbolos de perigo | |
| Códigos de risco | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Descrição da Segurança | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |