ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73952-83-7 1,4:3,6-dianidro-2-cloro-2-deoxi-D-glucitol |
|
| Nome do produto | 1,4:3,6-dianidro-2-cloro-2-deoxi-D-glucitol |
| Sinônimos | 1,4:3,6-Dianhydro-2-chloro-2-deoxy-D-glucitol; (3R,3aR,6S,6aS)-6-cloro-2,3,3a,5,6,6a-hexaidrofuro[2,3-d]furano-3-ol; |
| Nome em inglês | 1,4:3,6-dianhydro-2-chloro-2-deoxy-D-glucitol;1,4:3,6-Dianhydro-2-chloro-2-deoxy-D-glucitol;(3R,3aR,6S,6aS)-6-chloro-2,3,3a,5,6,6a-hexahydrofuro[2,3-d]furan-3-ol |
| Fórmula molecular | C6H9ClO3 |
| Peso Molecular | 164.5869 |
| InChI | InChI=1/C6H9ClO3/c7-3-1-9-6-4(8)2-10-5(3)6/h3-6,8H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| CAS Registry Number | 73952-83-7 |
| EINECS | 277-649-3 |
| Estrutura Molecular | ![]() |
| Densidade | 1.43g/cm3 |
| Ponto de ebulição | 340.7°C at 760 mmHg |
| índice de refração | 1.53 |
| O ponto de inflamação | 159.8°C |
| Pressão de vapor | 5.6E-06mmHg at 25°C |
| MSDS | |