ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
824-69-1 2,5-Dichlorohydroquinone |
|
| Nome do produto | 2,5-Dichlorohydroquinone |
| Nome em inglês | 2,5-Dichlorohydroquinone;2,5-Dichloro-1,4-dihydroxybenzene;2,5-Dichloro-1,4-hydroquinone;2,5-Dichloro-p-benzohydroquinone;2,5-Dichloro-p-hydroquinone;CCRIS 5677;NSC 48667;1,4-Benzenediol, 2,5-dichloro-;Hydroquinone, 2,5-dichloro- (8CI);2,5-dichlorobenzene-1,4-diol |
| Fórmula molecular | C6H4Cl2O2 |
| Peso Molecular | 179.0008 |
| InChI | InChI=1/C6H4Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H |
| CAS Registry Number | 824-69-1 |
| EINECS | 212-533-8 |
| Estrutura Molecular | ![]() |
| Densidade | 1.624g/cm3 |
| Ponto de fusão | 167-174℃ |
| Ponto de ebulição | 274°C at 760 mmHg |
| índice de refração | 1.642 |
| O ponto de inflamação | 119.5°C |
| Pressão de vapor | 0.00332mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.:; |
| Descrição da Segurança | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |