ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93739-18-5 S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate) |
|
| Nome do produto | S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate) |
| Nome em inglês | S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate); |
| Fórmula molecular | C10H16N2O4S2 |
| Peso Molecular | 292.375 |
| InChI | InChI=1/C10H16N2O4S2/c1-7(13)11-3-5-17-9(15)10(16)18-6-4-12-8(2)14/h3-6H2,1-2H3,(H,11,13)(H,12,14) |
| CAS Registry Number | 93739-18-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.284g/cm3 |
| Ponto de ebulição | 570.2°C at 760 mmHg |
| índice de refração | 1.542 |
| O ponto de inflamação | 298.6°C |
| Pressão de vapor | 5.18E-13mmHg at 25°C |
| MSDS | |