ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
| Nome do produto | 3,5-Dimethylphenylthiourea |
| Nome em inglês | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
| Fórmula molecular | C9H12N2S |
| Peso Molecular | 180.27 |
| InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| CAS Registry Number | 97480-60-9 |
| Estrutura Molecular | ![]() |
| Densidade | 1.2g/cm3 |
| Ponto de ebulição | 293.9°C at 760 mmHg |
| índice de refração | 1.674 |
| O ponto de inflamação | 131.5°C |
| Pressão de vapor | 0.00168mmHg at 25°C |
| Códigos de risco | R25##Toxic if swallowed.:; |
| Descrição da Segurança | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |