ChemIndex - Бесплатная база данных CAS по химическим веществамToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
| Название продукта | 1-(4-fluorophenyl)-2-thiourea |
| Английское название | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
| Молекулярная формула | C7H7FN2S |
| Молекулярный вес | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Регистрационный номер CAS | 459-05-2 |
| Молекулярная структура | ![]() |
| Плотность | 1.397g/cm3 |
| Температура плавления | 164℃ |
| Точка кипения | 264.2°C at 760 mmHg |
| Показатель преломления | 1.692 |
| Температура вспышки | 113.6°C |
| Давление пара | 0.00987mmHg at 25°C |
| Риск коды | R25##Toxic if swallowed.:; |
| Характеристики безопасности | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |