ChemIndex - Бесплатная база данных CAS по химическим веществамToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
| Название продукта | 3,5-Dimethylphenylthiourea |
| Английское название | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
| Молекулярная формула | C9H12N2S |
| Молекулярный вес | 180.27 |
| InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| Регистрационный номер CAS | 97480-60-9 |
| Молекулярная структура | ![]() |
| Плотность | 1.2g/cm3 |
| Точка кипения | 293.9°C at 760 mmHg |
| Показатель преломления | 1.674 |
| Температура вспышки | 131.5°C |
| Давление пара | 0.00168mmHg at 25°C |
| Риск коды | R25##Toxic if swallowed.:; |
| Характеристики безопасности | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |