ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-49-6 2-Methoxyethyl acetate |
|
| اسم المنتج | 2-Methoxyethyl acetate |
| الاسم بالانجليزية | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| الصيغة الجزيئية | C4H8O2S |
| الوزن الجزيئي الغرامي | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| إستراتيجية المساعدة القطرية | 110-49-6 |
| المفوضية الأوروبية رقم | 203-772-9 |
| بنية جزيئية | ![]() |
| كثافة | 1.072g/cm3 |
| درجة الإنصهار | -65℃ |
| نقطة الغليان | 162.7°C at 760 mmHg |
| معامل الإنكسار | 1.452 |
| نقطة الوميض | 57.6°C |
| ضغط البخار | 2.14mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| شروط الأمن | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |