Chemindex > 216019-28-2
SA ▼
216019-28-2 3-Isopropylbenzeneboronic acid |
|
| اسم المنتج | 3-Isopropylbenzeneboronic acid |
| الاسم بالانجليزية | 3-Isopropylbenzeneboronic acid;3-Cumylboronic acid;3-Isopropylphenylboronic acid;(3-Isopropylphenyl)boronic acid;[3-(1-methylethyl)phenyl]boronic acid;3-isopropylphenylboronicacid;3-Isoprophenylboronic Acid |
| الصيغة الجزيئية | C9H13BO2 |
| الوزن الجزيئي الغرامي | 164.0093 |
| InChI | InChI=1/C9H13BO2/c1-7(2)8-4-3-5-9(6-8)10(11)12/h3-7,11-12H,1-2H3 |
| إستراتيجية المساعدة القطرية | 216019-28-2 |
| بنية جزيئية |  |
| كثافة | 1.04g/cm3 |
| نقطة الغليان | 294.2°C at 760 mmHg |
| معامل الإنكسار | 1.513 |
| نقطة الوميض | 131.7°C |
| ضغط البخار | 0.000747mmHg at 25°C |
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 