ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22395-24-0 3',4',7-Trimethoxyflavone | 
    |
| اسم المنتج | 3',4',7-Trimethoxyflavone | 
| الاسم بالانجليزية | 3',4',7-Trimethoxyflavone;7,3',4'-Trimethoxyflavone;2-(3,4-Dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-7-methoxy-;2-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one | 
| الصيغة الجزيئية | C18H16O5 | 
| الوزن الجزيئي الغرامي | 312.3166 | 
| InChI | InChI=1/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 | 
| إستراتيجية المساعدة القطرية | 22395-24-0 | 
| بنية جزيئية | ![]()  | 
    
| كثافة | 1.242g/cm3 | 
| نقطة الغليان | 477.4°C at 760 mmHg | 
| معامل الإنكسار | 1.585 | 
| نقطة الوميض | 212°C | 
| ضغط البخار | 2.81E-09mmHg at 25°C | 
| شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |