ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27151-57-1 4,4'-Dimethoxy-N-methyldiphenylamine |
|
اسم المنتج | 4,4'-Dimethoxy-N-methyldiphenylamine |
الاسم بالانجليزية | 4,4'-Dimethoxy-N-methyldiphenylamine;N-(4-Methoxyphenyl)-N-methyl-p-anisidine;4-methoxy-N-(4-methoxyphenyl)-N-methylaniline |
الصيغة الجزيئية | C15H17NO2 |
الوزن الجزيئي الغرامي | 243.301 |
InChI | InChI=1/C15H17NO2/c1-16(12-4-8-14(17-2)9-5-12)13-6-10-15(18-3)11-7-13/h4-11H,1-3H3 |
إستراتيجية المساعدة القطرية | 27151-57-1 |
المفوضية الأوروبية رقم | 248-265-3 |
بنية جزيئية | ![]() |
كثافة | 1.095g/cm3 |
نقطة الغليان | 387.3°C at 760 mmHg |
معامل الإنكسار | 1.578 |
نقطة الوميض | 145.9°C |
ضغط البخار | 3.32E-06mmHg at 25°C |
خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |