Chemindex > 28162-63-2
SA ▼
28162-63-2 4-chloro-2-nitrophenyl isocyanate |
|
| اسم المنتج | 4-chloro-2-nitrophenyl isocyanate |
| الاسم بالانجليزية | 4-chloro-2-nitrophenyl isocyanate;4-chloro-1-isocyanato-2-nitrobenzene |
| الصيغة الجزيئية | C7H3ClN2O3 |
| الوزن الجزيئي الغرامي | 198.5633 |
| InChI | InChI=1/C7H3ClN2O3/c8-5-1-2-6(9-4-11)7(3-5)10(12)13/h1-3H |
| إستراتيجية المساعدة القطرية | 28162-63-2 |
| بنية جزيئية |  |
| كثافة | 1.48g/cm3 |
| درجة الإنصهار | 65-68℃ |
| نقطة الغليان | 298.5°C at 760 mmHg |
| معامل الإنكسار | 1.612 |
| نقطة الوميض | 134.3°C |
| ضغط البخار | 0.00127mmHg at 25°C |
| خطر المصطلحات | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
| شروط الأمن | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 28162-63-2 (0):
يتم توفير خدمة قاعدة بيانات CAS الكي&# 