ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33018-91-6 Monoethylpimelate |
|
اسم المنتج | Monoethylpimelate |
الاسم بالانجليزية | Monoethylpimelate;Ethyl hydrogen pimelate;Heptanedioic acid monoethyl ester;Monoethyl pimelate;Pimelic acid monoethyl ester;Ethylhydrogenpimelate;Pimelicacidmonoethylester;7-ethoxy-7-oxoheptanoic acid;Boc-His(Tos)-Merrifield resin |
الصيغة الجزيئية | C9H16O4 |
الوزن الجزيئي الغرامي | 188.2209 |
InChI | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
إستراتيجية المساعدة القطرية | 33018-91-6 |
المفوضية الأوروبية رقم | 251-346-6 |
بنية جزيئية | ![]() |
كثافة | 1.074g/cm3 |
نقطة الغليان | 288.7°C at 760 mmHg |
معامل الإنكسار | 1.449 |
نقطة الوميض | 108°C |
ضغط البخار | 0.000581mmHg at 25°C |
خطر المصطلحات | R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |