ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone |
|
اسم المنتج | 3',5'-dichloro-2'-hydroxyacetophenone |
الاسم بالانجليزية | 3',5'-dichloro-2'-hydroxyacetophenone;3,5-Dichloro-2-hydroxyacetophenone;1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
الصيغة الجزيئية | C8H6Cl2O2 |
الوزن الجزيئي الغرامي | 205.038 |
InChI | InChI=1/C8H6Cl2O2/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-3,12H,1H3 |
إستراتيجية المساعدة القطرية | 3321-92-4 |
بنية جزيئية | ![]() |
كثافة | 1.43g/cm3 |
درجة الإنصهار | 94-97℃ |
نقطة الغليان | 295.6°C at 760 mmHg |
معامل الإنكسار | 1.583 |
نقطة الوميض | 132.6°C |
ضغط البخار | 0.000856mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |