ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 350-90-3 Alpha-Fluorocinnamic acid | |
| اسم المنتج | Alpha-Fluorocinnamic acid | 
| الاسم بالانجليزية | Alpha-Fluorocinnamic acid;Cinnamic acid, alpha-fluoro-;1-09-00-00237 (Beilstein Handbook Reference);2-Fluoro-3-phenyl-2-propenoic acid;BRN 2501318;NSC 102780;alpha-Fluorocinnamic acid;2-Propenoic acid, 2-fluoro-3-phenyl- (9CI);2-fluoro-3-phenylprop-2-enoic acid;(2Z)-2-fluoro-3-phenylprop-2-enoate;(2Z)-2-fluoro-3-phenylprop-2-enoic acid | 
| الصيغة الجزيئية | C9H7FO2 | 
| الوزن الجزيئي الغرامي | 166.1491 | 
| InChI | InChI=1/C9H7FO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)/b8-6- | 
| إستراتيجية المساعدة القطرية | 350-90-3 | 
| المفوضية الأوروبية رقم | 206-508-0 | 
| بنية جزيئية |  | 
| كثافة | 1.275g/cm3 | 
| درجة الإنصهار | 156-160℃ | 
| نقطة الغليان | 289.3°C at 760 mmHg | 
| معامل الإنكسار | 1.585 | 
| نقطة الوميض | 128.7°C | 
| ضغط البخار | 0.00103mmHg at 25°C | 
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; | 
| MSDS | |