ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36847-94-6 N-(2-Methoxyphenyl)maleamic acid |
|
اسم المنتج | N-(2-Methoxyphenyl)maleamic acid |
الاسم بالانجليزية | N-(2-Methoxyphenyl)maleamic acid;(2Z)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoic acid;(2E)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoate |
الصيغة الجزيئية | C11H10NO4 |
الوزن الجزيئي الغرامي | 220.2019 |
InChI | InChI=1/C11H11NO4/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/p-1/b7-6+ |
إستراتيجية المساعدة القطرية | 36847-94-6 |
بنية جزيئية | ![]() |
نقطة الغليان | 468.9°C at 760 mmHg |
نقطة الوميض | 237.4°C |
ضغط البخار | 1.35E-09mmHg at 25°C |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |