ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide) |
|
| اسم المنتج | Oxalic acid bis(cyclohexylidenehydrazide) |
| الاسم بالانجليزية | Oxalic acid bis(cyclohexylidenehydrazide);Cuprizon 1;Bis(cyclohexanone)oxaldihydrazone;oxalic bis(cyclohexylidenehydrazide);N,N-oxalylbis(cyclohexanone hydrazone);Cuprizon l;cuprizon;Oxalic acid bis (cyclohexylidenehydrazide);N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| الصيغة الجزيئية | C14H22N4O2 |
| الوزن الجزيئي الغرامي | 278.3501 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| إستراتيجية المساعدة القطرية | 370-81-0 |
| المفوضية الأوروبية رقم | 206-729-2 |
| بنية جزيئية | ![]() |
| كثافة | 1.29g/cm3 |
| درجة الإنصهار | 208-214℃ |
| معامل الإنكسار | 1.625 |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R21/22##Harmful in contact with skin and if swallowed.:; |
| شروط الأمن | S2##Keep out of reach of children||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |