ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43111-31-5 2-Chlorophenoxyacetonitrile |
|
| اسم المنتج | 2-Chlorophenoxyacetonitrile |
| الاسم بالانجليزية | 2-Chlorophenoxyacetonitrile; |
| الصيغة الجزيئية | C8H6ClNO |
| الوزن الجزيئي الغرامي | 167.5923 |
| InChI | InChI=1/C8H6ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,6H2 |
| إستراتيجية المساعدة القطرية | 43111-31-5 |
| بنية جزيئية | ![]() |
| كثافة | 1.238g/cm3 |
| نقطة الغليان | 276.7°C at 760 mmHg |
| معامل الإنكسار | 1.538 |
| نقطة الوميض | 121.2°C |
| ضغط البخار | 0.00472mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| شروط الأمن | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |