ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-31-4 Desyl chloride |
|
| اسم المنتج | Desyl chloride |
| الاسم بالانجليزية | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
| الصيغة الجزيئية | C14H11ClO |
| الوزن الجزيئي الغرامي | 230.6895 |
| InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
| إستراتيجية المساعدة القطرية | 447-31-4 |
| المفوضية الأوروبية رقم | 207-181-7 |
| بنية جزيئية | ![]() |
| كثافة | 1.19g/cm3 |
| درجة الإنصهار | 65-69℃ |
| نقطة الغليان | 345.5°C at 760 mmHg |
| معامل الإنكسار | 1.592 |
| نقطة الوميض | 190.4°C |
| ضغط البخار | 6.14E-05mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
| شروط الأمن | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
| MSDS | |