ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
| اسم المنتج | 1-(4-fluorophenyl)-2-thiourea |
| الاسم بالانجليزية | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
| الصيغة الجزيئية | C7H7FN2S |
| الوزن الجزيئي الغرامي | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| إستراتيجية المساعدة القطرية | 459-05-2 |
| بنية جزيئية | ![]() |
| كثافة | 1.397g/cm3 |
| درجة الإنصهار | 164℃ |
| نقطة الغليان | 264.2°C at 760 mmHg |
| معامل الإنكسار | 1.692 |
| نقطة الوميض | 113.6°C |
| ضغط البخار | 0.00987mmHg at 25°C |
| خطر المصطلحات | R25##Toxic if swallowed.:; |
| شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |