ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5412-69-1 5-Diethylamino-2-pentanol |
|
اسم المنتج | 5-Diethylamino-2-pentanol |
الاسم بالانجليزية | 5-Diethylamino-2-pentanol;5-Diethylaminopentan-2-ol;(4S)-N,N-diethyl-4-hydroxypentan-1-aminium;(4R)-N,N-diethyl-4-hydroxypentan-1-aminium |
الصيغة الجزيئية | C9H22NO |
الوزن الجزيئي الغرامي | 160.2765 |
InChI | InChI=1/C9H21NO/c1-4-10(5-2)8-6-7-9(3)11/h9,11H,4-8H2,1-3H3/p+1/t9-/m1/s1 |
إستراتيجية المساعدة القطرية | 5412-69-1 |
المفوضية الأوروبية رقم | 226-497-6 |
بنية جزيئية | ![]() |
نقطة الغليان | 218.6°C at 760 mmHg |
نقطة الوميض | 70.2°C |
ضغط البخار | 0.0264mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
MSDS |