ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
اسم المنتج | 4-Chloro-3-nitrobenzophenone |
الاسم بالانجليزية | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
الصيغة الجزيئية | C13H8ClNO3 |
الوزن الجزيئي الغرامي | 261.6605 |
InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
إستراتيجية المساعدة القطرية | 56107-02-9 |
المفوضية الأوروبية رقم | 259-995-7 |
بنية جزيئية | ![]() |
كثافة | 1.367g/cm3 |
درجة الإنصهار | 101-107℃ |
نقطة الغليان | 386.5°C at 760 mmHg |
معامل الإنكسار | 1.623 |
نقطة الوميض | 203.4°C |
ضغط البخار | 3.53E-06mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R20/21##Harmful by inhalation and in contact with skin.:; |
شروط الأمن | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |