ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5989-27-5 (+)-Limonene |
|
| اسم المنتج | (+)-Limonene |
| الاسم بالانجليزية | (+)-Limonene;D-Limonene;Limonene 145;(R)-p-mentha-1,8-diene;(R)-(+)-4-Isopropenyl-1-methylcyclohexene;(+)-p-Mentha-1,8-diene;(4R)-1-methyl-4-(prop-1-en-2-yl)cyclohexene |
| الصيغة الجزيئية | C10H16 |
| الوزن الجزيئي الغرامي | 136.234 |
| InChI | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| إستراتيجية المساعدة القطرية | 5989-27-5 |
| المفوضية الأوروبية رقم | 227-813-5 |
| بنية جزيئية | ![]() |
| كثافة | 0.834g/cm3 |
| درجة الإنصهار | -74℃ |
| نقطة الغليان | 175.4°C at 760 mmHg |
| معامل الإنكسار | 1.467 |
| نقطة الوميض | 42.8°C |
| ضغط البخار | 1.54mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R10##Flammable.||R38##Irritating to skin.||R43##May cause sensitization by skin contact.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| شروط الأمن | S24##Avoid contact with skin.||S37##Wear suitable gloves.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |