Chemindex > 62524-21-4
SA ▼
62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide |
|
| اسم المنتج | 3-chlorobenzo[b]thiophene-2-carbohydrazide |
| الاسم بالانجليزية | 3-chlorobenzo[b]thiophene-2-carbohydrazide;3-chloro-1-benzothiophene-2-carbohydrazide;3-Chlorobenzothiophene-2-carboxylic acid hydrazide |
| الصيغة الجزيئية | C9H7ClN2OS |
| الوزن الجزيئي الغرامي | 226.6827 |
| InChI | InChI=1/C9H7ClN2OS/c10-7-5-3-1-2-4-6(5)14-8(7)9(13)12-11/h1-4H,11H2,(H,12,13) |
| إستراتيجية المساعدة القطرية | 62524-21-4 |
| بنية جزيئية | ![62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide](https://images-a.chemnet.com/suppliers/chembase/132/13230.gif "62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide") |
| كثافة | 1.486g/cm3 |
| درجة الإنصهار | 181℃ |
| معامل الإنكسار | 1.714 |
| علامات على البضائع الخطرة |  Xi##Irritant:; |
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 62524-21-4 (0):
يتم توفير خدمة قاعدة بيانات CAS الكي&# 