ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide |
|
اسم المنتج | 3-chlorobenzo[b]thiophene-2-carbohydrazide |
الاسم بالانجليزية | 3-chlorobenzo[b]thiophene-2-carbohydrazide;3-chloro-1-benzothiophene-2-carbohydrazide;3-Chlorobenzothiophene-2-carboxylic acid hydrazide |
الصيغة الجزيئية | C9H7ClN2OS |
الوزن الجزيئي الغرامي | 226.6827 |
InChI | InChI=1/C9H7ClN2OS/c10-7-5-3-1-2-4-6(5)14-8(7)9(13)12-11/h1-4H,11H2,(H,12,13) |
إستراتيجية المساعدة القطرية | 62524-21-4 |
بنية جزيئية | ![]() |
كثافة | 1.486g/cm3 |
درجة الإنصهار | 181℃ |
معامل الإنكسار | 1.714 |
علامات على البضائع الخطرة | |
خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |