ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68411-40-5 Benzene, 1,2-dimethyl-, reaction products with styrene |
|
اسم المنتج | Benzene, 1,2-dimethyl-, reaction products with styrene |
الاسم بالانجليزية | Benzene, 1,2-dimethyl-, reaction products with styrene;Distyrylxylene;1,2-dimethylbenzene - ethenylbenzene (1:1) |
الصيغة الجزيئية | C16H18 |
الوزن الجزيئي الغرامي | 210.3141 |
InChI | InChI=1/C8H10.C8H8/c1-7-5-3-4-6-8(7)2;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-7H,1H2 |
إستراتيجية المساعدة القطرية | 68411-40-5 |
المفوضية الأوروبية رقم | 270-121-3 |
بنية جزيئية | ![]() |
نقطة الغليان | 145.9°C at 760 mmHg |
نقطة الوميض | 29.2°C |
ضغط البخار | 5.99mmHg at 25°C |
MSDS |